C15H15N3O8S — CID 21405483
4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2-[(2-nitrophenyl)sulfanylamino]butanedioate (PubChem CID 21405483) has the molecular formula C15H15N3O8S and a molecular weight of 397.37 g/mol. Its IUPAC name is 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2-[(2-nitrophenyl)sulfanylamino]butanedioate.
| Compound Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2-[(2-nitrophenyl)sulfanylamino]butanedioate |
|---|---|
| PubChem CID | 21405483 |
| Molecular Formula | C15H15N3O8S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2-[(2-nitrophenyl)sulfanylamino]butanedioate |
| SMILES | COC(=O)C(CC(=O)ON1C(=O)CCC1=O)NSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O8S/c1-25-15(22)9(8-14(21)26-17-12(19)6-7-13(17)20)16-27-11-5-3-2-4-10(11)18(23)24/h2-5,9,16H,6-8H2,1H3 |
| InChIKey | IDSQALFBRHCPBM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|