C11H14N2O4S2 — CID 129360518
(2R)-4-methylsulfanyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid (PubChem CID 129360518) has the molecular formula C11H14N2O4S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid |
|---|---|
| PubChem CID | 129360518 |
| Molecular Formula | C11H14N2O4S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid |
| SMILES | CSCC[C@@H](NSc1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H14N2O4S2/c1-18-7-6-8(11(14)15)12-19-10-5-3-2-4-9(10)13(16)17/h2-5,8,12H,6-7H2,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | VIKNEZQWTWSVSG-MRVPVSSYSA-N |
| XLogP | 2.40 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|