C15H13N2O5S- — CID 6945385
(2R)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoate (PubChem CID 6945385) has the molecular formula C15H13N2O5S- and a molecular weight of 333.35 g/mol. Its IUPAC name is (2R)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoate.
| Compound Name | (2R)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoate |
|---|---|
| PubChem CID | 6945385 |
| Molecular Formula | C15H13N2O5S- |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (2R)-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoate |
| SMILES | O=C([O-])[C@@H](Cc1ccc(O)cc1)NSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N2O5S/c18-11-7-5-10(6-8-11)9-12(15(19)20)16-23-14-4-2-1-3-13(14)17(21)22/h1-8,12,16,18H,9H2,(H,19,20)/p-1/t12-/m1/s1 |
| InChIKey | VICFQGTUBSTZHS-GFCCVEGCSA-M |
| XLogP | 1.26 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|