C28H31N3O5S — CID 165343510
benzyl (2S)-4-methyl-2-[[(2S)-2-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoyl]amino]pentanoate (PubChem CID 165343510) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is benzyl (2S)-4-methyl-2-[[(2S)-2-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoyl]amino]pentanoate.
| Compound Name | benzyl (2S)-4-methyl-2-[[(2S)-2-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 165343510 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | benzyl (2S)-4-methyl-2-[[(2S)-2-[(2-nitrophenyl)sulfanylamino]-3-phenylpropanoyl]amino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NSc1ccccc1[N+](=O)[O-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H31N3O5S/c1-20(2)17-24(28(33)36-19-22-13-7-4-8-14-22)29-27(32)23(18-21-11-5-3-6-12-21)30-37-26-16-10-9-15-25(26)31(34)35/h3-16,20,23-24,30H,17-19H2,1-2H3,(H,29,32)/t23-,24-/m0/s1 |
| InChIKey | NNYBCLIQHPGDLJ-ZEQRLZLVSA-N |
| XLogP | 5.08 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|