C41H47N3O6 — CID 101008698
benzyl (2S)-2-[[(2S)-2-[[2-[[acetyl(phenylmethoxy)amino]methyl]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate (PubChem CID 101008698) has the molecular formula C41H47N3O6 and a molecular weight of 677.84 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[[2-[[acetyl(phenylmethoxy)amino]methyl]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[[2-[[acetyl(phenylmethoxy)amino]methyl]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 101008698 |
| Molecular Formula | C41H47N3O6 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.35 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[[2-[[acetyl(phenylmethoxy)amino]methyl]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
| SMILES | CC(=O)N(CC(Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C41H47N3O6/c1-30(2)24-37(40(47)43-38(26-33-18-10-5-11-19-33)41(48)49-28-34-20-12-6-13-21-34)42-39(46)36(25-32-16-8-4-9-17-32)27-44(31(3)45)50-29-35-22-14-7-15-23-35/h4-23,30,36-38H,24-29H2,1-3H3,(H,42,46)(H,43,47)/t36?,37-,38-/m0/s1 |
| InChIKey | PCYQCEIHEPFREQ-RJHNEXDJSA-N |
| XLogP | 5.83 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|