C29H36ClN3O7 — CID 59706068
benzyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(2-chloroacetyl)oxypropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate (PubChem CID 59706068) has the molecular formula C29H36ClN3O7 and a molecular weight of 574.07 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(2-chloroacetyl)oxypropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(2-chloroacetyl)oxypropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59706068 |
| Molecular Formula | C29H36ClN3O7 |
| Molecular Weight | 574.07 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(2-chloroacetyl)oxypropanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
| SMILES | CC(=O)N[C@@H](COC(=O)CCl)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H36ClN3O7/c1-19(2)14-23(32-28(37)25(31-20(3)34)18-39-26(35)16-30)27(36)33-24(15-21-10-6-4-7-11-21)29(38)40-17-22-12-8-5-9-13-22/h4-13,19,23-25H,14-18H2,1-3H3,(H,31,34)(H,32,37)(H,33,36)/t23-,24-,25-/m0/s1 |
| InChIKey | PZTMSNKISJGCPJ-SDHOMARFSA-N |
| XLogP | 2.27 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.07 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|