C12H16N2O4S — CID 92860184
(2R)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid (PubChem CID 92860184) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is (2R)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid |
|---|---|
| PubChem CID | 92860184 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2R)-4-methyl-2-[(2-nitrophenyl)sulfanylamino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NSc1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H16N2O4S/c1-8(2)7-9(12(15)16)13-19-11-6-4-3-5-10(11)14(17)18/h3-6,8-9,13H,7H2,1-2H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | OITRGNOZDXVYFU-SECBINFHSA-N |
| XLogP | 2.69 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|