C15H14N2O6S — CID 140979684
(2S)-3-hydroxy-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoic acid (PubChem CID 140979684) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is (2S)-3-hydroxy-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoic acid |
|---|---|
| PubChem CID | 140979684 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (2S)-3-hydroxy-3-(4-hydroxyphenyl)-2-[(2-nitrophenyl)sulfanylamino]propanoic acid |
| SMILES | O=C(O)[C@@H](NSc1ccccc1[N+](=O)[O-])C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H14N2O6S/c18-10-7-5-9(6-8-10)14(19)13(15(20)21)16-24-12-4-2-1-3-11(12)17(22)23/h1-8,13-14,16,18-19H,(H,20,21)/t13-,14?/m0/s1 |
| InChIKey | GNWARYPUBFUVHH-LSLKUGRBSA-N |
| XLogP | 2.08 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|