C40H36N2O10S — CID 18683369
4-[9-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenoxy]carbonyl-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-10-yl]butane-1-sulfonate (PubChem CID 18683369) has the molecular formula C40H36N2O10S and a molecular weight of 736.80 g/mol. Its IUPAC name is 4-[9-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenoxy]carbonyl-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-10-yl]butane-1-sulfonate.
| Compound Name | 4-[9-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenoxy]carbonyl-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-10-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 18683369 |
| Molecular Formula | C40H36N2O10S |
| Molecular Weight | 736.80 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | 4-[9-[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2,6-dimethylphenoxy]carbonyl-2-[(E)-2-(4-methoxyphenyl)ethenyl]acridin-10-ium-10-yl]butane-1-sulfonate |
| SMILES | COc1ccc(/C=C/c2ccc3c(c2)c(C(=O)Oc2c(C)cc(C(=O)ON4C(=O)CCC4=O)cc2C)c2ccccc2[n+]3CCCCS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C40H36N2O10S/c1-25-22-29(39(45)52-42-35(43)18-19-36(42)44)23-26(2)38(25)51-40(46)37-31-8-4-5-9-33(31)41(20-6-7-21-53(47,48)49)34-17-14-28(24-32(34)37)11-10-27-12-15-30(50-3)16-13-27/h4-5,8-17,22-24H,6-7,18-21H2,1-3H3/b11-10+ |
| InChIKey | RQEFQWGFHFAOQY-ZHACJKMWSA-N |
| XLogP | 5.84 |
| TPSA | 160.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|