C35H44N2O11S2+2 — CID 126603021
3-[9-(4-methoxycarbonyl-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 126603021) has the molecular formula C35H44N2O11S2+2 and a molecular weight of 732.87 g/mol. Its IUPAC name is 3-[9-(4-methoxycarbonyl-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[9-(4-methoxycarbonyl-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 126603021 |
| Molecular Formula | C35H44N2O11S2+2 |
| Molecular Weight | 732.87 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | 3-[9-(4-methoxycarbonyl-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | COC(=O)c1cc(C)c(OC(=O)c2c3ccccc3[n+](CCCS(=O)(=O)O)c3ccc(OCCC[N+](C)(C)CCCS(=O)(=O)O)cc23)c(C)c1 |
| InChI | InChI=1S/C35H42N2O11S2/c1-24-21-26(34(38)46-5)22-25(2)33(24)48-35(39)32-28-11-6-7-12-30(28)36(15-8-19-49(40,41)42)31-14-13-27(23-29(31)32)47-18-9-16-37(3,4)17-10-20-50(43,44)45/h6-7,11-14,21-23H,8-10,15-20H2,1-5H3/p+2 |
| InChIKey | AOYBFNHVNYFTRT-UHFFFAOYSA-P |
| XLogP | 4.30 |
| TPSA | 174.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|