C31H33NO13S2 — CID 164703688
3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-propoxy-7-(2-sulfooxyethoxy)acridin-10-ium-10-yl]propane-1-sulfonate (PubChem CID 164703688) has the molecular formula C31H33NO13S2 and a molecular weight of 691.73 g/mol. Its IUPAC name is 3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-propoxy-7-(2-sulfooxyethoxy)acridin-10-ium-10-yl]propane-1-sulfonate.
| Compound Name | 3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-propoxy-7-(2-sulfooxyethoxy)acridin-10-ium-10-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 164703688 |
| Molecular Formula | C31H33NO13S2 |
| Molecular Weight | 691.73 g/mol |
| Exact Mass | 691.14 |
| IUPAC Name | 3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-2-propoxy-7-(2-sulfooxyethoxy)acridin-10-ium-10-yl]propane-1-sulfonate |
| SMILES | CCCOc1ccc2c(c1)c(C(=O)Oc1c(C)cc(C(=O)O)cc1C)c1cc(OCCOS(=O)(=O)O)ccc1[n+]2CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C31H33NO13S2/c1-4-11-42-22-6-8-26-24(17-22)28(31(35)45-29-19(2)15-21(30(33)34)16-20(29)3)25-18-23(43-12-13-44-47(39,40)41)7-9-27(25)32(26)10-5-14-46(36,37)38/h6-9,15-18H,4-5,10-14H2,1-3H3,(H2-,33,34,36,37,38,39,40,41) |
| InChIKey | WJHQNEAGGNGOHI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 206.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|