C34H42N2O11S2+2 — CID 126603019
3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 126603019) has the molecular formula C34H42N2O11S2+2 and a molecular weight of 718.85 g/mol. Its IUPAC name is 3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 126603019 |
| Molecular Formula | C34H42N2O11S2+2 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.22 |
| IUPAC Name | 3-[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-(3-sulfopropyl)acridin-10-ium-2-yl]oxypropyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OC(=O)c1c2ccccc2[n+](CCCS(=O)(=O)O)c2ccc(OCCC[N+](C)(C)CCCS(=O)(=O)O)cc12 |
| InChI | InChI=1S/C34H40N2O11S2/c1-23-20-25(33(37)38)21-24(2)32(23)47-34(39)31-27-10-5-6-11-29(27)35(14-7-18-48(40,41)42)30-13-12-26(22-28(30)31)46-17-8-15-36(3,4)16-9-19-49(43,44)45/h5-6,10-13,20-22H,7-9,14-19H2,1-4H3,(H-2,37,38,40,41,42,43,44,45)/p+2 |
| InChIKey | JSODREPXNHWERJ-UHFFFAOYSA-P |
| XLogP | 4.22 |
| TPSA | 185.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|