C23H20NO5S+ — CID 154449006
3-(9-phenoxycarbonylacridin-10-ium-10-yl)propane-1-sulfonic acid (PubChem CID 154449006) has the molecular formula C23H20NO5S+ and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-(9-phenoxycarbonylacridin-10-ium-10-yl)propane-1-sulfonic acid.
| Compound Name | 3-(9-phenoxycarbonylacridin-10-ium-10-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 154449006 |
| Molecular Formula | C23H20NO5S+ |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 3-(9-phenoxycarbonylacridin-10-ium-10-yl)propane-1-sulfonic acid |
| SMILES | O=C(Oc1ccccc1)c1c2ccccc2[n+](CCCS(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C23H19NO5S/c25-23(29-17-9-2-1-3-10-17)22-18-11-4-6-13-20(18)24(15-8-16-30(26,27)28)21-14-7-5-12-19(21)22/h1-7,9-14H,8,15-16H2/p+1 |
| InChIKey | DTUNJRIAABDUAS-UHFFFAOYSA-O |
| XLogP | 3.78 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|