C38H47N4O9S+ — CID 121353927
5-[3-[3-[[3,5-dimethyl-4-[10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxybenzoyl]amino]propyl-methylamino]propylamino]-5-oxopentanoic acid (PubChem CID 121353927) has the molecular formula C38H47N4O9S+ and a molecular weight of 735.88 g/mol. Its IUPAC name is 5-[3-[3-[[3,5-dimethyl-4-[10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxybenzoyl]amino]propyl-methylamino]propylamino]-5-oxopentanoic acid.
| Compound Name | 5-[3-[3-[[3,5-dimethyl-4-[10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxybenzoyl]amino]propyl-methylamino]propylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 121353927 |
| Molecular Formula | C38H47N4O9S+ |
| Molecular Weight | 735.88 g/mol |
| Exact Mass | 735.31 |
| IUPAC Name | 5-[3-[3-[[3,5-dimethyl-4-[10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxybenzoyl]amino]propyl-methylamino]propylamino]-5-oxopentanoic acid |
| SMILES | Cc1cc(C(=O)NCCCN(C)CCCNC(=O)CCCC(=O)O)cc(C)c1OC(=O)c1c2ccccc2[n+](CCCS(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C38H46N4O9S/c1-26-24-28(37(46)40-19-10-21-41(3)20-9-18-39-33(43)16-8-17-34(44)45)25-27(2)36(26)51-38(47)35-29-12-4-6-14-31(29)42(22-11-23-52(48,49)50)32-15-7-5-13-30(32)35/h4-7,12-15,24-25H,8-11,16-23H2,1-3H3,(H3-,39,40,43,44,45,46,48,49,50)/p+1 |
| InChIKey | ZHERCOUDEUTGFN-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 183.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|