C40H54N3O13S+ — CID 59017873
3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2,6-dimethylphenoxy]carbonyl-2,7-bis[2-(2-methoxyethoxy)ethoxy]acridin-10-ium-10-yl]propane-1-sulfonic acid (PubChem CID 59017873) has the molecular formula C40H54N3O13S+ and a molecular weight of 816.95 g/mol. Its IUPAC name is 3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2,6-dimethylphenoxy]carbonyl-2,7-bis[2-(2-methoxyethoxy)ethoxy]acridin-10-ium-10-yl]propane-1-sulfonic acid.
| Compound Name | 3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2,6-dimethylphenoxy]carbonyl-2,7-bis[2-(2-methoxyethoxy)ethoxy]acridin-10-ium-10-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59017873 |
| Molecular Formula | C40H54N3O13S+ |
| Molecular Weight | 816.95 g/mol |
| Exact Mass | 816.34 |
| IUPAC Name | 3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2,6-dimethylphenoxy]carbonyl-2,7-bis[2-(2-methoxyethoxy)ethoxy]acridin-10-ium-10-yl]propane-1-sulfonic acid |
| SMILES | COCCOCCOc1ccc2c(c1)c(C(=O)Oc1c(C)cc(C(=O)NCCOCCN)cc1C)c1cc(OCCOCCOC)ccc1[n+]2CCCS(=O)(=O)O |
| InChI | InChI=1S/C40H53N3O13S/c1-28-24-30(39(44)42-11-14-51-13-10-41)25-29(2)38(28)56-40(45)37-33-26-31(54-21-19-52-17-15-49-3)6-8-35(33)43(12-5-23-57(46,47)48)36-9-7-32(27-34(36)37)55-22-20-53-18-16-50-4/h6-9,24-27H,5,10-23,41H2,1-4H3,(H-,42,44,46,47,48)/p+1 |
| InChIKey | YQHDVSNIBRKATF-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 204.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.95 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|