C31H36N3O8S+ — CID 59283864
3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2-(methoxymethyl)-6-methylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid (PubChem CID 59283864) has the molecular formula C31H36N3O8S+ and a molecular weight of 610.71 g/mol. Its IUPAC name is 3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2-(methoxymethyl)-6-methylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid.
| Compound Name | 3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2-(methoxymethyl)-6-methylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59283864 |
| Molecular Formula | C31H36N3O8S+ |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 3-[9-[4-[2-(2-aminoethoxy)ethylcarbamoyl]-2-(methoxymethyl)-6-methylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid |
| SMILES | COCc1cc(C(=O)NCCOCCN)cc(C)c1OC(=O)c1c2ccccc2[n+](CCCS(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C31H35N3O8S/c1-21-18-22(30(35)33-13-16-41-15-12-32)19-23(20-40-2)29(21)42-31(36)28-24-8-3-5-10-26(24)34(14-7-17-43(37,38)39)27-11-6-4-9-25(27)28/h3-6,8-11,18-19H,7,12-17,20,32H2,1-2H3,(H-,33,35,37,38,39)/p+1 |
| InChIKey | MIMWKJGIDRSSRM-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|