C52H76NO21S+ — CID 164823701
4-[2,7-bis[1,3-bis[2-(2-methoxyethoxy)ethoxy]propan-2-yloxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3,5-dimethylbenzoic acid (PubChem CID 164823701) has the molecular formula C52H76NO21S+ and a molecular weight of 1083.23 g/mol. Its IUPAC name is 4-[2,7-bis[1,3-bis[2-(2-methoxyethoxy)ethoxy]propan-2-yloxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3,5-dimethylbenzoic acid.
| Compound Name | 4-[2,7-bis[1,3-bis[2-(2-methoxyethoxy)ethoxy]propan-2-yloxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 164823701 |
| Molecular Formula | C52H76NO21S+ |
| Molecular Weight | 1083.23 g/mol |
| Exact Mass | 1082.46 |
| IUPAC Name | 4-[2,7-bis[1,3-bis[2-(2-methoxyethoxy)ethoxy]propan-2-yloxy]-10-(3-sulfopropyl)acridin-10-ium-9-carbonyl]oxy-3,5-dimethylbenzoic acid |
| SMILES | COCCOCCOCC(COCCOCCOC)Oc1ccc2c(c1)c(C(=O)Oc1c(C)cc(C(=O)O)cc1C)c1cc(OC(COCCOCCOC)COCCOCCOC)ccc1[n+]2CCCS(=O)(=O)O |
| InChI | InChI=1S/C52H75NO21S/c1-38-30-40(51(54)55)31-39(2)50(38)74-52(56)49-45-32-41(72-43(34-68-25-21-64-17-13-60-3)35-69-26-22-65-18-14-61-4)8-10-47(45)53(12-7-29-75(57,58)59)48-11-9-42(33-46(48)49)73-44(36-70-27-23-66-19-15-62-5)37-71-28-24-67-20-16-63-6/h8-11,30-33,43-44H,7,12-29,34-37H2,1-6H3,(H-,54,55,57,58,59)/p+1 |
| InChIKey | PQRAGVUUHJHFAX-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 251.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|