C30H33N2O6S+ — CID 121353929
3-[9-[4-(butylcarbamoyl)-2,6-dimethylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid (PubChem CID 121353929) has the molecular formula C30H33N2O6S+ and a molecular weight of 549.67 g/mol. Its IUPAC name is 3-[9-[4-(butylcarbamoyl)-2,6-dimethylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid.
| Compound Name | 3-[9-[4-(butylcarbamoyl)-2,6-dimethylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 121353929 |
| Molecular Formula | C30H33N2O6S+ |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 3-[9-[4-(butylcarbamoyl)-2,6-dimethylphenoxy]carbonylacridin-10-ium-10-yl]propane-1-sulfonic acid |
| SMILES | CCCCNC(=O)c1cc(C)c(OC(=O)c2c3ccccc3[n+](CCCS(=O)(=O)O)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C30H32N2O6S/c1-4-5-15-31-29(33)22-18-20(2)28(21(3)19-22)38-30(34)27-23-11-6-8-13-25(23)32(16-10-17-39(35,36)37)26-14-9-7-12-24(26)27/h6-9,11-14,18-19H,4-5,10,15-17H2,1-3H3,(H-,31,33,35,36,37)/p+1 |
| InChIKey | PCAPDRJDFJSBBB-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|