C34H39N3O9S2 — CID 122589460
3-[9-[[4-(5-carboxypentylamino)-4-oxobutyl]-(4-methylphenyl)sulfonylcarbamoyl]acridin-10-ium-10-yl]propane-1-sulfonate (PubChem CID 122589460) has the molecular formula C34H39N3O9S2 and a molecular weight of 697.83 g/mol. Its IUPAC name is 3-[9-[[4-(5-carboxypentylamino)-4-oxobutyl]-(4-methylphenyl)sulfonylcarbamoyl]acridin-10-ium-10-yl]propane-1-sulfonate.
| Compound Name | 3-[9-[[4-(5-carboxypentylamino)-4-oxobutyl]-(4-methylphenyl)sulfonylcarbamoyl]acridin-10-ium-10-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 122589460 |
| Molecular Formula | C34H39N3O9S2 |
| Molecular Weight | 697.83 g/mol |
| Exact Mass | 697.21 |
| IUPAC Name | 3-[9-[[4-(5-carboxypentylamino)-4-oxobutyl]-(4-methylphenyl)sulfonylcarbamoyl]acridin-10-ium-10-yl]propane-1-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCC(=O)NCCCCCC(=O)O)C(=O)c2c3ccccc3[n+](CCCS(=O)(=O)[O-])c3ccccc23)cc1 |
| InChI | InChI=1S/C34H39N3O9S2/c1-25-17-19-26(20-18-25)48(45,46)37(23-9-15-31(38)35-21-8-2-3-16-32(39)40)34(41)33-27-11-4-6-13-29(27)36(22-10-24-47(42,43)44)30-14-7-5-12-28(30)33/h4-7,11-14,17-20H,2-3,8-10,15-16,21-24H2,1H3,(H2-,35,38,39,40,42,43,44) |
| InChIKey | MTTAGQHIEBZCRQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 181.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.83 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|