C37H43N4O5S+ — CID 145224994
N-(4-methylphenyl)sulfonyl-N-[4-oxo-4-[[6-oxo-6-(propan-2-ylamino)hexyl]amino]butyl]-10-prop-2-ynylacridin-10-ium-9-carboxamide (PubChem CID 145224994) has the molecular formula C37H43N4O5S+ and a molecular weight of 655.84 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-N-[4-oxo-4-[[6-oxo-6-(propan-2-ylamino)hexyl]amino]butyl]-10-prop-2-ynylacridin-10-ium-9-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-N-[4-oxo-4-[[6-oxo-6-(propan-2-ylamino)hexyl]amino]butyl]-10-prop-2-ynylacridin-10-ium-9-carboxamide |
|---|---|
| PubChem CID | 145224994 |
| Molecular Formula | C37H43N4O5S+ |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-N-[4-oxo-4-[[6-oxo-6-(propan-2-ylamino)hexyl]amino]butyl]-10-prop-2-ynylacridin-10-ium-9-carboxamide |
| SMILES | C#CC[n+]1c2ccccc2c(C(=O)N(CCCC(=O)NCCCCCC(=O)NC(C)C)S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C37H42N4O5S/c1-5-25-40-32-16-10-8-14-30(32)36(31-15-9-11-17-33(31)40)37(44)41(47(45,46)29-22-20-28(4)21-23-29)26-13-19-34(42)38-24-12-6-7-18-35(43)39-27(2)3/h1,8-11,14-17,20-23,27H,6-7,12-13,18-19,24-26H2,2-4H3,(H-,38,39,42,43)/p+1 |
| InChIKey | MJOMIOKKIXDGOB-UHFFFAOYSA-O |
| XLogP | 5.03 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|