C35H43N4O5S+ — CID 167597512
4-[[10-[4-[(4-aminocyclohexyl)amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 167597512) has the molecular formula C35H43N4O5S+ and a molecular weight of 631.82 g/mol. Its IUPAC name is 4-[[10-[4-[(4-aminocyclohexyl)amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[[10-[4-[(4-aminocyclohexyl)amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 167597512 |
| Molecular Formula | C35H43N4O5S+ |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 4-[[10-[4-[(4-aminocyclohexyl)amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCC(=O)O)C(=O)c2c3ccccc3[n+](CCCCNC3CCC(N)CC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C35H42N4O5S/c1-25-14-20-28(21-15-25)45(43,44)39(24-8-13-33(40)41)35(42)34-29-9-2-4-11-31(29)38(32-12-5-3-10-30(32)34)23-7-6-22-37-27-18-16-26(36)17-19-27/h2-5,9-12,14-15,20-21,26-27,37H,6-8,13,16-19,22-24,36H2,1H3/p+1 |
| InChIKey | JGXGGUUHIDQGRO-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|