C24H21N2O5S+ — CID 22013521
2-[(10-methylacridin-10-ium-9-carbonyl)-(4-methylphenyl)sulfonylamino]acetic acid (PubChem CID 22013521) has the molecular formula C24H21N2O5S+ and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[(10-methylacridin-10-ium-9-carbonyl)-(4-methylphenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(10-methylacridin-10-ium-9-carbonyl)-(4-methylphenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 22013521 |
| Molecular Formula | C24H21N2O5S+ |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-[(10-methylacridin-10-ium-9-carbonyl)-(4-methylphenyl)sulfonylamino]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)O)C(=O)c2c3ccccc3[n+](C)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H20N2O5S/c1-16-11-13-17(14-12-16)32(30,31)26(15-22(27)28)24(29)23-18-7-3-5-9-20(18)25(2)21-10-6-4-8-19(21)23/h3-14H,15H2,1-2H3/p+1 |
| InChIKey | RUMQUMOXRZBOCT-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|