C28H29N2O5S+ — CID 122589476
4-[(4-methylphenyl)sulfonyl-(10-propylacridin-10-ium-9-carbonyl)amino]butanoic acid (PubChem CID 122589476) has the molecular formula C28H29N2O5S+ and a molecular weight of 505.62 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfonyl-(10-propylacridin-10-ium-9-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(4-methylphenyl)sulfonyl-(10-propylacridin-10-ium-9-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122589476 |
| Molecular Formula | C28H29N2O5S+ |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 4-[(4-methylphenyl)sulfonyl-(10-propylacridin-10-ium-9-carbonyl)amino]butanoic acid |
| SMILES | CCC[n+]1c2ccccc2c(C(=O)N(CCCC(=O)O)S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H28N2O5S/c1-3-18-29-24-11-6-4-9-22(24)27(23-10-5-7-12-25(23)29)28(33)30(19-8-13-26(31)32)36(34,35)21-16-14-20(2)15-17-21/h4-7,9-12,14-17H,3,8,13,18-19H2,1-2H3/p+1 |
| InChIKey | VRASAJJAFICDFU-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|