C37H49N4O7S+ — CID 167703419
4-[[10-[4-[methyl-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 167703419) has the molecular formula C37H49N4O7S+ and a molecular weight of 693.89 g/mol. Its IUPAC name is 4-[[10-[4-[methyl-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-[[10-[4-[methyl-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 167703419 |
| Molecular Formula | C37H49N4O7S+ |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | 4-[[10-[4-[methyl-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]amino]butyl]acridin-10-ium-9-carbonyl]-(4-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | CNCCOCCOCCN(C)CCCC[n+]1c2ccccc2c(C(=O)N(CCCC(=O)O)S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C37H48N4O7S/c1-29-16-18-30(19-17-29)49(45,46)41(23-10-15-35(42)43)37(44)36-31-11-4-6-13-33(31)40(34-14-7-5-12-32(34)36)22-9-8-21-39(3)24-26-48-28-27-47-25-20-38-2/h4-7,11-14,16-19,38H,8-10,15,20-28H2,1-3H3/p+1 |
| InChIKey | YSUJTLHQCQGIAA-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|