C38H45N6O5S+ — CID 157402706
10-[(1-ethyltriazol-4-yl)methyl]-N-[11-(methylamino)-4,11-dioxoundecyl]-N-(4-methylphenyl)sulfonylacridin-10-ium-9-carboxamide (PubChem CID 157402706) has the molecular formula C38H45N6O5S+ and a molecular weight of 697.88 g/mol. Its IUPAC name is 10-[(1-ethyltriazol-4-yl)methyl]-N-[11-(methylamino)-4,11-dioxoundecyl]-N-(4-methylphenyl)sulfonylacridin-10-ium-9-carboxamide.
| Compound Name | 10-[(1-ethyltriazol-4-yl)methyl]-N-[11-(methylamino)-4,11-dioxoundecyl]-N-(4-methylphenyl)sulfonylacridin-10-ium-9-carboxamide |
|---|---|
| PubChem CID | 157402706 |
| Molecular Formula | C38H45N6O5S+ |
| Molecular Weight | 697.88 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | 10-[(1-ethyltriazol-4-yl)methyl]-N-[11-(methylamino)-4,11-dioxoundecyl]-N-(4-methylphenyl)sulfonylacridin-10-ium-9-carboxamide |
| SMILES | CCn1cc(C[n+]2c3ccccc3c(C(=O)N(CCCC(=O)CCCCCCC(=O)NC)S(=O)(=O)c3ccc(C)cc3)c3ccccc32)nn1 |
| InChI | InChI=1S/C38H44N6O5S/c1-4-42-26-29(40-41-42)27-43-34-18-11-9-16-32(34)37(33-17-10-12-19-35(33)43)38(47)44(50(48,49)31-23-21-28(2)22-24-31)25-13-15-30(45)14-7-5-6-8-20-36(46)39-3/h9-12,16-19,21-24,26H,4-8,13-15,20,25,27H2,1-3H3/p+1 |
| InChIKey | UBRFJTBCQUAWMP-UHFFFAOYSA-O |
| XLogP | 5.52 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|