About (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate
(4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate (PubChem CID 162192051) has the molecular formula C44H36N2O4+2
and a molecular weight of 656.78 g/mol. Its IUPAC name is (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate.
Molecular Properties
| Compound Name | (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate |
| PubChem CID | 162192051 |
| Molecular Formula | C44H36N2O4+2 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2c3ccccc3[n+](C)c3ccccc23)cc1.Cc1ccc(OC(=O)c2c3ccccc3[n+](C)c3ccccc23)cc1 |
| InChI | InChI=1S/2C22H18NO2/c2*1-15-11-13-16(14-12-15)25-22(24)21-17-7-3-5-9-19(17)23(2)20-10-6-4-8-18(20)21/h2*3-14H,1-2H3/q2*+1 |
| InChIKey | ZQKXVRKPMXZVNQ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate?
The IUPAC name of (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate (CID 162192051) is (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate.
What is the SMILES notation for (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate?
The canonical SMILES for (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate is Cc1ccc(OC(=O)c2c3ccccc3[n+](C)c3ccccc23)cc1.Cc1ccc(OC(=O)c2c3ccccc3[n+](C)c3ccccc23)cc1.
What is the InChIKey of (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate?
The InChIKey is ZQKXVRKPMXZVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C22H18NO2/c2*1-15-11-13-16(14-12-15)25-22(24)21-17-7-3-5-9-19(17)23(2)20-10-6-4-8-18(20)21/h2*3-14H,1-2H3/q2*+1.
What are the key properties of (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate?
(4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate has a molecular weight of 656.78 g/mol, XLogP of 8.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) 10-methylacridin-10-ium-9-carboxylate is sourced from PubChem (CID 162192051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).