About disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate
disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate (PubChem CID 21043493) has the molecular formula C21H15NNa2O6P+
and a molecular weight of 454.31 g/mol. Its IUPAC name is disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate.
Molecular Properties
| Compound Name | disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate |
| PubChem CID | 21043493 |
| Molecular Formula | C21H15NNa2O6P+ |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate |
| SMILES | C[n+]1c2ccccc2c(C(=O)Oc2ccc(OP(=O)([O-])[O-])cc2)c2ccccc21.[Na+].[Na+] |
| InChI | InChI=1S/C21H16NO6P.2Na/c1-22-18-8-4-2-6-16(18)20(17-7-3-5-9-19(17)22)21(23)27-14-10-12-15(13-11-14)28-29(24,25)26;;/h2-13H,1H3,(H-,24,25,26);;/q;2*+1/p-1 |
| InChIKey | IWIXZNDDNCRJGM-UHFFFAOYSA-M |
| XLogP | -3.75 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate?
The IUPAC name of disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate (CID 21043493) is disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate.
What is the SMILES notation for disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate?
The canonical SMILES for disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate is C[n+]1c2ccccc2c(C(=O)Oc2ccc(OP(=O)([O-])[O-])cc2)c2ccccc21.[Na+].[Na+].
What is the InChIKey of disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate?
The InChIKey is IWIXZNDDNCRJGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H16NO6P.2Na/c1-22-18-8-4-2-6-16(18)20(17-7-3-5-9-19(17)22)21(23)27-14-10-12-15(13-11-14)28-29(24,25)26;;/h2-13H,1H3,(H-,24,25,26);;/q;2*+1/p-1.
What are the key properties of disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate?
disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate has a molecular weight of 454.31 g/mol, XLogP of -3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[4-(10-methylacridin-10-ium-9-carbonyl)oxyphenyl] phosphate is sourced from PubChem (CID 21043493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).