C24H19NNa2O8P+ — CID 21043525
disodium;[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methylacridin-10-ium-2-yl] phosphate (PubChem CID 21043525) has the molecular formula C24H19NNa2O8P+ and a molecular weight of 526.37 g/mol. Its IUPAC name is disodium;[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methylacridin-10-ium-2-yl] phosphate.
| Compound Name | disodium;[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methylacridin-10-ium-2-yl] phosphate |
|---|---|
| PubChem CID | 21043525 |
| Molecular Formula | C24H19NNa2O8P+ |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | disodium;[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-10-methylacridin-10-ium-2-yl] phosphate |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OC(=O)c1c2ccccc2[n+](C)c2ccc(OP(=O)([O-])[O-])cc12.[Na+].[Na+] |
| InChI | InChI=1S/C24H20NO8P.2Na/c1-13-10-15(23(26)27)11-14(2)22(13)32-24(28)21-17-6-4-5-7-19(17)25(3)20-9-8-16(12-18(20)21)33-34(29,30)31;;/h4-12H,1-3H3,(H2-,26,27,29,30,31);;/q;2*+1/p-1 |
| InChIKey | YJARWDQPEHUBBE-UHFFFAOYSA-M |
| XLogP | -3.43 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|