C31H26NO4+ — CID 14855202
(2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 10-methylacridin-10-ium-9-carboxylate (PubChem CID 14855202) has the molecular formula C31H26NO4+ and a molecular weight of 476.55 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 10-methylacridin-10-ium-9-carboxylate.
| Compound Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 10-methylacridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 14855202 |
| Molecular Formula | C31H26NO4+ |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 10-methylacridin-10-ium-9-carboxylate |
| SMILES | Cc1cc(C(=O)OCc2ccccc2)cc(C)c1OC(=O)c1c2ccccc2[n+](C)c2ccccc12 |
| InChI | InChI=1S/C31H26NO4/c1-20-17-23(30(33)35-19-22-11-5-4-6-12-22)18-21(2)29(20)36-31(34)28-24-13-7-9-15-26(24)32(3)27-16-10-8-14-25(27)28/h4-18H,19H2,1-3H3/q+1 |
| InChIKey | HNZFUFLHAAVFDE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|