C32H28NO8P — CID 21043522
(2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-dimethoxyphosphoryloxyacridine-9-carboxylate (PubChem CID 21043522) has the molecular formula C32H28NO8P and a molecular weight of 585.55 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-dimethoxyphosphoryloxyacridine-9-carboxylate.
| Compound Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-dimethoxyphosphoryloxyacridine-9-carboxylate |
|---|---|
| PubChem CID | 21043522 |
| Molecular Formula | C32H28NO8P |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 2-dimethoxyphosphoryloxyacridine-9-carboxylate |
| SMILES | COP(=O)(OC)Oc1ccc2nc3ccccc3c(C(=O)Oc3c(C)cc(C(=O)OCc4ccccc4)cc3C)c2c1 |
| InChI | InChI=1S/C32H28NO8P/c1-20-16-23(31(34)39-19-22-10-6-5-7-11-22)17-21(2)30(20)40-32(35)29-25-12-8-9-13-27(25)33-28-15-14-24(18-26(28)29)41-42(36,37-3)38-4/h5-18H,19H2,1-4H3 |
| InChIKey | IVEVJIVEKLFZGS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|