C59H48NO9P — CID 58704028
(2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(Z)-1-bis(phenylmethoxy)phosphoryloxy-2-(4-phenylmethoxyphenyl)ethenyl]acridine-9-carboxylate (PubChem CID 58704028) has the molecular formula C59H48NO9P and a molecular weight of 946.00 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(Z)-1-bis(phenylmethoxy)phosphoryloxy-2-(4-phenylmethoxyphenyl)ethenyl]acridine-9-carboxylate.
| Compound Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(Z)-1-bis(phenylmethoxy)phosphoryloxy-2-(4-phenylmethoxyphenyl)ethenyl]acridine-9-carboxylate |
|---|---|
| PubChem CID | 58704028 |
| Molecular Formula | C59H48NO9P |
| Molecular Weight | 946.00 g/mol |
| Exact Mass | 945.31 |
| IUPAC Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(Z)-1-bis(phenylmethoxy)phosphoryloxy-2-(4-phenylmethoxyphenyl)ethenyl]acridine-9-carboxylate |
| SMILES | Cc1cc(C(=O)OCc2ccccc2)cc(C)c1OC(=O)c1c2ccccc2nc2cc(/C(=C/c3ccc(OCc4ccccc4)cc3)OP(=O)(OCc3ccccc3)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C59H48NO9P/c1-41-33-49(58(61)65-38-45-19-9-4-10-20-45)34-42(2)57(41)68-59(62)56-51-25-15-16-26-53(51)60-54-36-48(29-32-52(54)56)55(35-43-27-30-50(31-28-43)64-37-44-17-7-3-8-18-44)69-70(63,66-39-46-21-11-5-12-22-46)67-40-47-23-13-6-14-24-47/h3-36H,37-40H2,1-2H3/b55-35- |
| InChIKey | JIJKDWOEYTXZFP-VQKAKURTSA-N |
| XLogP | 14.22 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.00 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|