C25H21NO6 — CID 88878421
(4-methoxycarbonyl-2,6-dimethylphenyl) 2-hydroxy-7-methoxyacridine-9-carboxylate (PubChem CID 88878421) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is (4-methoxycarbonyl-2,6-dimethylphenyl) 2-hydroxy-7-methoxyacridine-9-carboxylate.
| Compound Name | (4-methoxycarbonyl-2,6-dimethylphenyl) 2-hydroxy-7-methoxyacridine-9-carboxylate |
|---|---|
| PubChem CID | 88878421 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (4-methoxycarbonyl-2,6-dimethylphenyl) 2-hydroxy-7-methoxyacridine-9-carboxylate |
| SMILES | COC(=O)c1cc(C)c(OC(=O)c2c3cc(O)ccc3nc3ccc(OC)cc23)c(C)c1 |
| InChI | InChI=1S/C25H21NO6/c1-13-9-15(24(28)31-4)10-14(2)23(13)32-25(29)22-18-11-16(27)5-7-20(18)26-21-8-6-17(30-3)12-19(21)22/h5-12,27H,1-4H3 |
| InChIKey | BCAQIOIZHMQSBN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|