C48H45F6NO8S2 — CID 166673042
(4-methoxycarbonyl-2,6-dimethylphenyl) 2,7-bis[3-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylpropoxy]acridine-9-carboxylate (PubChem CID 166673042) has the molecular formula C48H45F6NO8S2 and a molecular weight of 942.01 g/mol. Its IUPAC name is (4-methoxycarbonyl-2,6-dimethylphenyl) 2,7-bis[3-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylpropoxy]acridine-9-carboxylate.
| Compound Name | (4-methoxycarbonyl-2,6-dimethylphenyl) 2,7-bis[3-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylpropoxy]acridine-9-carboxylate |
|---|---|
| PubChem CID | 166673042 |
| Molecular Formula | C48H45F6NO8S2 |
| Molecular Weight | 942.01 g/mol |
| Exact Mass | 941.25 |
| IUPAC Name | (4-methoxycarbonyl-2,6-dimethylphenyl) 2,7-bis[3-[2,2,2-trifluoro-1-(4-methylphenyl)ethoxy]sulfanylpropoxy]acridine-9-carboxylate |
| SMILES | COC(=O)c1cc(C)c(OC(=O)c2c3cc(OCCCSOC(c4ccc(C)cc4)C(F)(F)F)ccc3nc3ccc(OCCCSOC(c4ccc(C)cc4)C(F)(F)F)cc23)c(C)c1 |
| InChI | InChI=1S/C48H45F6NO8S2/c1-28-8-12-32(13-9-28)43(47(49,50)51)62-64-22-6-20-59-35-16-18-39-37(26-35)41(46(57)61-42-30(3)24-34(25-31(42)4)45(56)58-5)38-27-36(17-19-40(38)55-39)60-21-7-23-65-63-44(48(52,53)54)33-14-10-29(2)11-15-33/h8-19,24-27,43-44H,6-7,20-23H2,1-5H3 |
| InChIKey | LGGMLKUZZXJZRT-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.01 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|