C40H53N3O6 — CID 122544481
(4-methoxycarbonyl-2,6-dimethylphenyl) 2-[5-(dimethylamino)-2,4-dimethylpentoxy]-7-[3-(dimethylamino)-2-methylbutoxy]acridine-9-carboxylate (PubChem CID 122544481) has the molecular formula C40H53N3O6 and a molecular weight of 671.88 g/mol. Its IUPAC name is (4-methoxycarbonyl-2,6-dimethylphenyl) 2-[5-(dimethylamino)-2,4-dimethylpentoxy]-7-[3-(dimethylamino)-2-methylbutoxy]acridine-9-carboxylate.
| Compound Name | (4-methoxycarbonyl-2,6-dimethylphenyl) 2-[5-(dimethylamino)-2,4-dimethylpentoxy]-7-[3-(dimethylamino)-2-methylbutoxy]acridine-9-carboxylate |
|---|---|
| PubChem CID | 122544481 |
| Molecular Formula | C40H53N3O6 |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.39 |
| IUPAC Name | (4-methoxycarbonyl-2,6-dimethylphenyl) 2-[5-(dimethylamino)-2,4-dimethylpentoxy]-7-[3-(dimethylamino)-2-methylbutoxy]acridine-9-carboxylate |
| SMILES | COC(=O)c1cc(C)c(OC(=O)c2c3cc(OCC(C)CC(C)CN(C)C)ccc3nc3ccc(OCC(C)C(C)N(C)C)cc23)c(C)c1 |
| InChI | InChI=1S/C40H53N3O6/c1-24(21-42(7)8)16-25(2)22-47-31-12-14-35-33(19-31)37(40(45)49-38-26(3)17-30(18-27(38)4)39(44)46-11)34-20-32(13-15-36(34)41-35)48-23-28(5)29(6)43(9)10/h12-15,17-20,24-25,28-29H,16,21-23H2,1-11H3 |
| InChIKey | COVFLOOLYUUBKP-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|