C36H29NO5 — CID 21459665
(2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-ethoxybenzo[b]acridine-12-carboxylate (PubChem CID 21459665) has the molecular formula C36H29NO5 and a molecular weight of 555.63 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-ethoxybenzo[b]acridine-12-carboxylate.
| Compound Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-ethoxybenzo[b]acridine-12-carboxylate |
|---|---|
| PubChem CID | 21459665 |
| Molecular Formula | C36H29NO5 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-ethoxybenzo[b]acridine-12-carboxylate |
| SMILES | CCOc1ccc2c(C(=O)Oc3c(C)cc(C(=O)OCc4ccccc4)cc3C)c3cc4ccccc4cc3nc2c1 |
| InChI | InChI=1S/C36H29NO5/c1-4-40-28-14-15-29-32(20-28)37-31-19-26-13-9-8-12-25(26)18-30(31)33(29)36(39)42-34-22(2)16-27(17-23(34)3)35(38)41-21-24-10-6-5-7-11-24/h5-20H,4,21H2,1-3H3 |
| InChIKey | FELFEGIWCKLJHA-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|