C39H28N2O6 — CID 22114777
(2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(1,3-dioxoisoindol-2-yl)methyl]acridine-9-carboxylate (PubChem CID 22114777) has the molecular formula C39H28N2O6 and a molecular weight of 620.66 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(1,3-dioxoisoindol-2-yl)methyl]acridine-9-carboxylate.
| Compound Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(1,3-dioxoisoindol-2-yl)methyl]acridine-9-carboxylate |
|---|---|
| PubChem CID | 22114777 |
| Molecular Formula | C39H28N2O6 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | (2,6-dimethyl-4-phenylmethoxycarbonylphenyl) 3-[(1,3-dioxoisoindol-2-yl)methyl]acridine-9-carboxylate |
| SMILES | Cc1cc(C(=O)OCc2ccccc2)cc(C)c1OC(=O)c1c2ccccc2nc2cc(CN3C(=O)c4ccccc4C3=O)ccc12 |
| InChI | InChI=1S/C39H28N2O6/c1-23-18-27(38(44)46-22-25-10-4-3-5-11-25)19-24(2)35(23)47-39(45)34-30-14-8-9-15-32(30)40-33-20-26(16-17-31(33)34)21-41-36(42)28-12-6-7-13-29(28)37(41)43/h3-20H,21-22H2,1-2H3 |
| InChIKey | VZJBTSORRMOFQA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|