C28H27NO5 — CID 89316556
(4-butoxycarbonyl-2,6-dimethylphenyl) 4-methoxyacridine-9-carboxylate (PubChem CID 89316556) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is (4-butoxycarbonyl-2,6-dimethylphenyl) 4-methoxyacridine-9-carboxylate.
| Compound Name | (4-butoxycarbonyl-2,6-dimethylphenyl) 4-methoxyacridine-9-carboxylate |
|---|---|
| PubChem CID | 89316556 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (4-butoxycarbonyl-2,6-dimethylphenyl) 4-methoxyacridine-9-carboxylate |
| SMILES | CCCCOC(=O)c1cc(C)c(OC(=O)c2c3ccccc3nc3c(OC)cccc23)c(C)c1 |
| InChI | InChI=1S/C28H27NO5/c1-5-6-14-33-27(30)19-15-17(2)26(18(3)16-19)34-28(31)24-20-10-7-8-12-22(20)29-25-21(24)11-9-13-23(25)32-4/h7-13,15-16H,5-6,14H2,1-4H3 |
| InChIKey | QPNBSDUQWKSLAW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|