C30H31NO7 — CID 89316585
(4-butoxycarbonyl-2,6-dimethylphenyl) 2,4,7-trimethoxyacridine-9-carboxylate (PubChem CID 89316585) has the molecular formula C30H31NO7 and a molecular weight of 517.58 g/mol. Its IUPAC name is (4-butoxycarbonyl-2,6-dimethylphenyl) 2,4,7-trimethoxyacridine-9-carboxylate.
| Compound Name | (4-butoxycarbonyl-2,6-dimethylphenyl) 2,4,7-trimethoxyacridine-9-carboxylate |
|---|---|
| PubChem CID | 89316585 |
| Molecular Formula | C30H31NO7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | (4-butoxycarbonyl-2,6-dimethylphenyl) 2,4,7-trimethoxyacridine-9-carboxylate |
| SMILES | CCCCOC(=O)c1cc(C)c(OC(=O)c2c3cc(OC)ccc3nc3c(OC)cc(OC)cc23)c(C)c1 |
| InChI | InChI=1S/C30H31NO7/c1-7-8-11-37-29(32)19-12-17(2)28(18(3)13-19)38-30(33)26-22-14-20(34-4)9-10-24(22)31-27-23(26)15-21(35-5)16-25(27)36-6/h9-10,12-16H,7-8,11H2,1-6H3 |
| InChIKey | BKSJIVJIWAATSR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|