C24H19NO4 — CID 91210999
(4-methoxycarbonylphenyl) 2,6-dimethylacridine-9-carboxylate (PubChem CID 91210999) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 2,6-dimethylacridine-9-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 2,6-dimethylacridine-9-carboxylate |
|---|---|
| PubChem CID | 91210999 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (4-methoxycarbonylphenyl) 2,6-dimethylacridine-9-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2c3ccc(C)cc3nc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C24H19NO4/c1-14-5-11-20-19(12-14)22(18-10-4-15(2)13-21(18)25-20)24(27)29-17-8-6-16(7-9-17)23(26)28-3/h4-13H,1-3H3 |
| InChIKey | MOVQYTYVQWNFKY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|