C23H20N2O6 — CID 143363540
methyl 4-[(2,7-dihydroxyacridin-9-yl)oxyamino]oxy-3,5-dimethylbenzoate (PubChem CID 143363540) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is methyl 4-[(2,7-dihydroxyacridin-9-yl)oxyamino]oxy-3,5-dimethylbenzoate.
| Compound Name | methyl 4-[(2,7-dihydroxyacridin-9-yl)oxyamino]oxy-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 143363540 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | methyl 4-[(2,7-dihydroxyacridin-9-yl)oxyamino]oxy-3,5-dimethylbenzoate |
| SMILES | COC(=O)c1cc(C)c(ONOc2c3cc(O)ccc3nc3ccc(O)cc23)c(C)c1 |
| InChI | InChI=1S/C23H20N2O6/c1-12-8-14(23(28)29-3)9-13(2)21(12)30-25-31-22-17-10-15(26)4-6-19(17)24-20-7-5-16(27)11-18(20)22/h4-11,25-27H,1-3H3 |
| InChIKey | RHOSTJUIMZWNAD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|