C25H21NO9P- — CID 21043505
[9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-7-methoxy-10-methylacridin-10-ium-2-yl] phosphate (PubChem CID 21043505) has the molecular formula C25H21NO9P- and a molecular weight of 510.42 g/mol. Its IUPAC name is [9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-7-methoxy-10-methylacridin-10-ium-2-yl] phosphate.
| Compound Name | [9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-7-methoxy-10-methylacridin-10-ium-2-yl] phosphate |
|---|---|
| PubChem CID | 21043505 |
| Molecular Formula | C25H21NO9P- |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | [9-(4-carboxy-2,6-dimethylphenoxy)carbonyl-7-methoxy-10-methylacridin-10-ium-2-yl] phosphate |
| SMILES | COc1ccc2c(c1)c(C(=O)Oc1c(C)cc(C(=O)O)cc1C)c1cc(OP(=O)([O-])[O-])ccc1[n+]2C |
| InChI | InChI=1S/C25H22NO9P/c1-13-9-15(24(27)28)10-14(2)23(13)34-25(29)22-18-11-16(33-4)5-7-20(18)26(3)21-8-6-17(12-19(21)22)35-36(30,31)32/h5-12H,1-4H3,(H2-,27,28,30,31,32)/p-1 |
| InChIKey | GFLGPAZSRCGSFV-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|