C30H26N3O10+ — CID 91233177
(2,6-dimethyl-4-nitrophenyl) 2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]-7-methoxy-10-methylacridin-10-ium-9-carboxylate (PubChem CID 91233177) has the molecular formula C30H26N3O10+ and a molecular weight of 588.55 g/mol. Its IUPAC name is (2,6-dimethyl-4-nitrophenyl) 2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]-7-methoxy-10-methylacridin-10-ium-9-carboxylate.
| Compound Name | (2,6-dimethyl-4-nitrophenyl) 2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]-7-methoxy-10-methylacridin-10-ium-9-carboxylate |
|---|---|
| PubChem CID | 91233177 |
| Molecular Formula | C30H26N3O10+ |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | (2,6-dimethyl-4-nitrophenyl) 2-[2-(2,5-dihydroxypyrrol-1-yl)oxy-2-oxoethoxy]-7-methoxy-10-methylacridin-10-ium-9-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(=O)Oc1c(C)cc([N+](=O)[O-])cc1C)c1cc(OCC(=O)On3c(O)ccc3O)ccc1[n+]2C |
| InChI | InChI=1S/C30H25N3O10/c1-16-11-18(33(38)39)12-17(2)29(16)42-30(37)28-21-13-19(40-4)5-7-23(21)31(3)24-8-6-20(14-22(24)28)41-15-27(36)43-32-25(34)9-10-26(32)35/h5-14,37H,15H2,1-4H3/p+1 |
| InChIKey | QYNVQKWQUDGKLX-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|