C17H17NO7 — CID 170609245
3-[(2,6-dimethyl-4-nitrophenyl)methoxy]-5-hydroxy-4-methoxybenzoic acid (PubChem CID 170609245) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is 3-[(2,6-dimethyl-4-nitrophenyl)methoxy]-5-hydroxy-4-methoxybenzoic acid.
| Compound Name | 3-[(2,6-dimethyl-4-nitrophenyl)methoxy]-5-hydroxy-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 170609245 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[(2,6-dimethyl-4-nitrophenyl)methoxy]-5-hydroxy-4-methoxybenzoic acid |
| SMILES | COc1c(O)cc(C(=O)O)cc1OCc1c(C)cc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C17H17NO7/c1-9-4-12(18(22)23)5-10(2)13(9)8-25-15-7-11(17(20)21)6-14(19)16(15)24-3/h4-7,19H,8H2,1-3H3,(H,20,21) |
| InChIKey | VIIVDQSVQPWHNM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|