8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid

C15H16O5 — CID 51031692

IUPAC8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid
SMILESCCc1c(OC)c(OC)cc2c(O)cc(C(=O)O)cc12
InChIInChI=1S/C15H16O5/c1-4-9-10-5-8(15(17)18)6-12(16)11(10)7-13(19-2)14(9)20-3/h5-7,16H,4H2,1-3H3,(H,17,18)
InChIKeyYNBUTMJFWBVIMZ-UHFFFAOYSA-N
MW276.29 g/mol
LogP2.82
Rot. Bonds4

About 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid

8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid (PubChem CID 51031692) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid
PubChem CID51031692
Molecular FormulaC15H16O5
Molecular Weight276.29 g/mol
Exact Mass276.10
IUPAC Name8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid
SMILESCCc1c(OC)c(OC)cc2c(O)cc(C(=O)O)cc12
InChIInChI=1S/C15H16O5/c1-4-9-10-5-8(15(17)18)6-12(16)11(10)7-13(19-2)14(9)20-3/h5-7,16H,4H2,1-3H3,(H,17,18)
InChIKeyYNBUTMJFWBVIMZ-UHFFFAOYSA-N
XLogP2.82
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 52.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid?
The IUPAC name of 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid (CID 51031692) is 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid.
What is the SMILES notation for 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid?
The canonical SMILES for 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid is CCc1c(OC)c(OC)cc2c(O)cc(C(=O)O)cc12.
What is the InChIKey of 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid?
The InChIKey is YNBUTMJFWBVIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-4-9-10-5-8(15(17)18)6-12(16)11(10)7-13(19-2)14(9)20-3/h5-7,16H,4H2,1-3H3,(H,17,18).
What are the key properties of 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid?
8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid has a molecular weight of 276.29 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-4-hydroxy-6,7-dimethoxynaphthalene-2-carboxylic acid is sourced from PubChem (CID 51031692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).