C13H11BrO5 — CID 73013869
8-bromo-4-hydroxy-5,6-dimethoxynaphthalene-2-carboxylic acid (PubChem CID 73013869) has the molecular formula C13H11BrO5 and a molecular weight of 327.13 g/mol. Its IUPAC name is 8-bromo-4-hydroxy-5,6-dimethoxynaphthalene-2-carboxylic acid.
| Compound Name | 8-bromo-4-hydroxy-5,6-dimethoxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 73013869 |
| Molecular Formula | C13H11BrO5 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 8-bromo-4-hydroxy-5,6-dimethoxynaphthalene-2-carboxylic acid |
| SMILES | COc1cc(Br)c2cc(C(=O)O)cc(O)c2c1OC |
| InChI | InChI=1S/C13H11BrO5/c1-18-10-5-8(14)7-3-6(13(16)17)4-9(15)11(7)12(10)19-2/h3-5,15H,1-2H3,(H,16,17) |
| InChIKey | LJFLFXIJRPLPDZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |