C15H16O6 — CID 11358292
methyl 4-hydroxy-5,6,8-trimethoxynaphthalene-2-carboxylate (PubChem CID 11358292) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 4-hydroxy-5,6,8-trimethoxynaphthalene-2-carboxylate.
| Compound Name | methyl 4-hydroxy-5,6,8-trimethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11358292 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl 4-hydroxy-5,6,8-trimethoxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(O)c2c(OC)c(OC)cc(OC)c2c1 |
| InChI | InChI=1S/C15H16O6/c1-18-11-7-12(19-2)14(20-3)13-9(11)5-8(6-10(13)16)15(17)21-4/h5-7,16H,1-4H3 |
| InChIKey | IZSXXHXGMAHJPH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |