C9H10O8S — CID 71593489
methyl 3-hydroxy-5-methoxy-4-sulfooxybenzoate (PubChem CID 71593489) has the molecular formula C9H10O8S and a molecular weight of 278.24 g/mol. Its IUPAC name is methyl 3-hydroxy-5-methoxy-4-sulfooxybenzoate.
| Compound Name | methyl 3-hydroxy-5-methoxy-4-sulfooxybenzoate |
|---|---|
| PubChem CID | 71593489 |
| Molecular Formula | C9H10O8S |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | methyl 3-hydroxy-5-methoxy-4-sulfooxybenzoate |
| SMILES | COC(=O)c1cc(O)c(OS(=O)(=O)O)c(OC)c1 |
| InChI | InChI=1S/C9H10O8S/c1-15-7-4-5(9(11)16-2)3-6(10)8(7)17-18(12,13)14/h3-4,10H,1-2H3,(H,12,13,14) |
| InChIKey | FLFYNJOGDVBBMN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|