About methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate
methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate (PubChem CID 71616691) has the molecular formula C18H21NO6
and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate |
| PubChem CID | 71616691 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(N(C)c2ccc(OC)c(O)c2)c1 |
| InChI | InChI=1S/C18H21NO6/c1-19(12-6-7-15(22-2)14(20)10-12)13-8-11(18(21)25-5)9-16(23-3)17(13)24-4/h6-10,20H,1-5H3 |
| InChIKey | AYSFXMMIOLDOBC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate?
The IUPAC name of methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate (CID 71616691) is methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate.
What is the SMILES notation for methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate?
The canonical SMILES for methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate is COC(=O)c1cc(OC)c(OC)c(N(C)c2ccc(OC)c(O)c2)c1.
What is the InChIKey of methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate?
The InChIKey is AYSFXMMIOLDOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO6/c1-19(12-6-7-15(22-2)14(20)10-12)13-8-11(18(21)25-5)9-16(23-3)17(13)24-4/h6-10,20H,1-5H3.
What are the key properties of methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate?
methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate has a molecular weight of 347.37 g/mol, XLogP of 2.97, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-hydroxy-4-methoxy-N-methylanilino)-4,5-dimethoxybenzoate is sourced from PubChem (CID 71616691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).