C9H11N3O7S — CID 82914684
2-(2-methoxy-5-nitro-3-sulfamoylphenoxy)acetamide (PubChem CID 82914684) has the molecular formula C9H11N3O7S and a molecular weight of 305.27 g/mol. Its IUPAC name is 2-(2-methoxy-5-nitro-3-sulfamoylphenoxy)acetamide.
| Compound Name | 2-(2-methoxy-5-nitro-3-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 82914684 |
| Molecular Formula | C9H11N3O7S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-(2-methoxy-5-nitro-3-sulfamoylphenoxy)acetamide |
| SMILES | COc1c(OCC(N)=O)cc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H11N3O7S/c1-18-9-6(19-4-8(10)13)2-5(12(14)15)3-7(9)20(11,16)17/h2-3H,4H2,1H3,(H2,10,13)(H2,11,16,17) |
| InChIKey | LRJJOVIFCPWVJH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 164.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|