C10H10N4O6S — CID 82913043
N-(cyanomethyl)-2-(4-nitro-2-sulfamoylphenoxy)acetamide (PubChem CID 82913043) has the molecular formula C10H10N4O6S and a molecular weight of 314.28 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(4-nitro-2-sulfamoylphenoxy)acetamide.
| Compound Name | N-(cyanomethyl)-2-(4-nitro-2-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 82913043 |
| Molecular Formula | C10H10N4O6S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-(cyanomethyl)-2-(4-nitro-2-sulfamoylphenoxy)acetamide |
| SMILES | N#CCNC(=O)COc1ccc([N+](=O)[O-])cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10N4O6S/c11-3-4-13-10(15)6-20-8-2-1-7(14(16)17)5-9(8)21(12,18)19/h1-2,5H,4,6H2,(H,13,15)(H2,12,18,19) |
| InChIKey | SJDBPJGQESNDEL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|